C18H24N2O2S2 — CID 5002441
pentyl 2-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-ylsulfanyl)propanoate (PubChem CID 5002441) has the molecular formula C18H24N2O2S2 and a molecular weight of 364.54 g/mol. Its IUPAC name is pentyl 2-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-ylsulfanyl)propanoate.
| Compound Name | pentyl 2-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-ylsulfanyl)propanoate |
|---|---|
| PubChem CID | 5002441 |
| Molecular Formula | C18H24N2O2S2 |
| Molecular Weight | 364.54 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | pentyl 2-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-ylsulfanyl)propanoate |
| SMILES | CCCCCOC(=O)C(C)Sc1ncnc2sc3c(c12)CCCC3 |
| InChI | InChI=1S/C18H24N2O2S2/c1-3-4-7-10-22-18(21)12(2)23-16-15-13-8-5-6-9-14(13)24-17(15)20-11-19-16/h11-12H,3-10H2,1-2H3 |
| InChIKey | ZSSACXWNIGIZKM-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.54 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|