C20H15N3OS — CID 4162089
N-benzyl-8-thiophen-3-yl-1,6-naphthyridine-2-carboxamide (PubChem CID 4162089) has the molecular formula C20H15N3OS and a molecular weight of 345.43 g/mol. Its IUPAC name is N-benzyl-8-thiophen-3-yl-1,6-naphthyridine-2-carboxamide.
| Compound Name | N-benzyl-8-thiophen-3-yl-1,6-naphthyridine-2-carboxamide |
|---|---|
| PubChem CID | 4162089 |
| Molecular Formula | C20H15N3OS |
| Molecular Weight | 345.43 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | N-benzyl-8-thiophen-3-yl-1,6-naphthyridine-2-carboxamide |
| SMILES | O=C(NCc1ccccc1)c1ccc2cncc(-c3ccsc3)c2n1 |
| InChI | InChI=1S/C20H15N3OS/c24-20(22-10-14-4-2-1-3-5-14)18-7-6-15-11-21-12-17(19(15)23-18)16-8-9-25-13-16/h1-9,11-13H,10H2,(H,22,24) |
| InChIKey | KCEHTFVIPBQDOP-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.43 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |