C22H18Cl2N2O5S — CID 4163249
ethyl 4-[[2-[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carbonyl]sulfanylacetyl]amino]benzoate (PubChem CID 4163249) has the molecular formula C22H18Cl2N2O5S and a molecular weight of 493.37 g/mol. Its IUPAC name is ethyl 4-[[2-[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carbonyl]sulfanylacetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carbonyl]sulfanylacetyl]amino]benzoate |
|---|---|
| PubChem CID | 4163249 |
| Molecular Formula | C22H18Cl2N2O5S |
| Molecular Weight | 493.37 g/mol |
| Exact Mass | 492.03 |
| IUPAC Name | ethyl 4-[[2-[3-(2,6-dichlorophenyl)-5-methyl-1,2-oxazole-4-carbonyl]sulfanylacetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)CSC(=O)c2c(-c3c(Cl)cccc3Cl)noc2C)cc1 |
| InChI | InChI=1S/C22H18Cl2N2O5S/c1-3-30-21(28)13-7-9-14(10-8-13)25-17(27)11-32-22(29)18-12(2)31-26-20(18)19-15(23)5-4-6-16(19)24/h4-10H,3,11H2,1-2H3,(H,25,27) |
| InChIKey | PNRLGNYJNNXJMS-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 98.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.37 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|