C27H23F3N4O2S — CID 4163351
3-[4-[2-oxo-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]phenyl]-2-sulfanylidene-1H-quinazolin-4-one (PubChem CID 4163351) has the molecular formula C27H23F3N4O2S and a molecular weight of 524.57 g/mol. Its IUPAC name is 3-[4-[2-oxo-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]phenyl]-2-sulfanylidene-1H-quinazolin-4-one.
| Compound Name | 3-[4-[2-oxo-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]phenyl]-2-sulfanylidene-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 4163351 |
| Molecular Formula | C27H23F3N4O2S |
| Molecular Weight | 524.57 g/mol |
| Exact Mass | 524.15 |
| IUPAC Name | 3-[4-[2-oxo-2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]phenyl]-2-sulfanylidene-1H-quinazolin-4-one |
| SMILES | O=C(Cc1ccc(-n2c(=S)[nH]c3ccccc3c2=O)cc1)N1CCN(c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C27H23F3N4O2S/c28-27(29,30)19-4-3-5-21(17-19)32-12-14-33(15-13-32)24(35)16-18-8-10-20(11-9-18)34-25(36)22-6-1-2-7-23(22)31-26(34)37/h1-11,17H,12-16H2,(H,31,37) |
| InChIKey | XDBUNXOVXQBCSF-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 61.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.57 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|