C21H14FN3O4 — CID 4168378
1-(4-fluorophenyl)-4-[[5-(4-nitrophenyl)cyclopenta-1,3-dien-1-yl]methylidene]pyrazolidine-3,5-dione (PubChem CID 4168378) has the molecular formula C21H14FN3O4 and a molecular weight of 391.36 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-4-[[5-(4-nitrophenyl)cyclopenta-1,3-dien-1-yl]methylidene]pyrazolidine-3,5-dione.
| Compound Name | 1-(4-fluorophenyl)-4-[[5-(4-nitrophenyl)cyclopenta-1,3-dien-1-yl]methylidene]pyrazolidine-3,5-dione |
|---|---|
| PubChem CID | 4168378 |
| Molecular Formula | C21H14FN3O4 |
| Molecular Weight | 391.36 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | 1-(4-fluorophenyl)-4-[[5-(4-nitrophenyl)cyclopenta-1,3-dien-1-yl]methylidene]pyrazolidine-3,5-dione |
| SMILES | O=C1NN(c2ccc(F)cc2)C(=O)C1=CC1=CC=CC1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H14FN3O4/c22-15-6-10-16(11-7-15)24-21(27)19(20(26)23-24)12-14-2-1-3-18(14)13-4-8-17(9-5-13)25(28)29/h1-12,18H,(H,23,26) |
| InChIKey | ILCQSAGVHSTMCM-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.36 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|