C25H28N4O3S — CID 4170888
3-[(4-methylphenyl)sulfonylamino]-4-piperidin-1-yl-N-(pyridin-3-ylmethyl)benzamide (PubChem CID 4170888) has the molecular formula C25H28N4O3S and a molecular weight of 464.59 g/mol. Its IUPAC name is 3-[(4-methylphenyl)sulfonylamino]-4-piperidin-1-yl-N-(pyridin-3-ylmethyl)benzamide.
| Compound Name | 3-[(4-methylphenyl)sulfonylamino]-4-piperidin-1-yl-N-(pyridin-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 4170888 |
| Molecular Formula | C25H28N4O3S |
| Molecular Weight | 464.59 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | 3-[(4-methylphenyl)sulfonylamino]-4-piperidin-1-yl-N-(pyridin-3-ylmethyl)benzamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2cc(C(=O)NCc3cccnc3)ccc2N2CCCCC2)cc1 |
| InChI | InChI=1S/C25H28N4O3S/c1-19-7-10-22(11-8-19)33(31,32)28-23-16-21(9-12-24(23)29-14-3-2-4-15-29)25(30)27-18-20-6-5-13-26-17-20/h5-13,16-17,28H,2-4,14-15,18H2,1H3,(H,27,30) |
| InChIKey | XXXJRLVWZQNFMO-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.59 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |