C46H34ClN3O6 — CID 4174647
2-[4-(1,3-benzoxazol-2-yl)phenyl]-8-(3-chlorophenyl)-6-(2-hydroxy-3-methylphenyl)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 4174647) has the molecular formula C46H34ClN3O6 and a molecular weight of 760.25 g/mol. Its IUPAC name is 2-[4-(1,3-benzoxazol-2-yl)phenyl]-8-(3-chlorophenyl)-6-(2-hydroxy-3-methylphenyl)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 2-[4-(1,3-benzoxazol-2-yl)phenyl]-8-(3-chlorophenyl)-6-(2-hydroxy-3-methylphenyl)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 4174647 |
| Molecular Formula | C46H34ClN3O6 |
| Molecular Weight | 760.25 g/mol |
| Exact Mass | 759.21 |
| IUPAC Name | 2-[4-(1,3-benzoxazol-2-yl)phenyl]-8-(3-chlorophenyl)-6-(2-hydroxy-3-methylphenyl)-6a-phenyl-4,6,9a,10,10a,10b-hexahydro-3aH-isoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | Cc1cccc(C2C3=CCC4C(=O)N(c5ccc(-c6nc7ccccc7o6)cc5)C(=O)C4C3CC3C(=O)N(c4cccc(Cl)c4)C(=O)C32c2ccccc2)c1O |
| InChI | InChI=1S/C46H34ClN3O6/c1-25-9-7-14-33(40(25)51)39-31-21-22-32-38(44(54)49(42(32)52)29-19-17-26(18-20-29)41-48-36-15-5-6-16-37(36)56-41)34(31)24-35-43(53)50(30-13-8-12-28(47)23-30)45(55)46(35,39)27-10-3-2-4-11-27/h2-21,23,32,34-35,38-39,51H,22,24H2,1H3 |
| InChIKey | NAXYAOXOZNTVAG-UHFFFAOYSA-N |
| XLogP | 8.53 |
| TPSA | 121.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.25 |
| LogP ≤ 5 | 8.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|