C21H26N4O3 — CID 4174798
N-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]-3-phenyl-N-(2-pyrrolidin-1-ylethyl)prop-2-enamide (PubChem CID 4174798) has the molecular formula C21H26N4O3 and a molecular weight of 382.46 g/mol. Its IUPAC name is N-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]-3-phenyl-N-(2-pyrrolidin-1-ylethyl)prop-2-enamide.
| Compound Name | N-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]-3-phenyl-N-(2-pyrrolidin-1-ylethyl)prop-2-enamide |
|---|---|
| PubChem CID | 4174798 |
| Molecular Formula | C21H26N4O3 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | N-[2-[(5-methyl-1,2-oxazol-3-yl)amino]-2-oxoethyl]-3-phenyl-N-(2-pyrrolidin-1-ylethyl)prop-2-enamide |
| SMILES | Cc1cc(NC(=O)CN(CCN2CCCC2)C(=O)C=Cc2ccccc2)no1 |
| InChI | InChI=1S/C21H26N4O3/c1-17-15-19(23-28-17)22-20(26)16-25(14-13-24-11-5-6-12-24)21(27)10-9-18-7-3-2-4-8-18/h2-4,7-10,15H,5-6,11-14,16H2,1H3,(H,22,23,26) |
| InChIKey | FEBQHCGISFMLHV-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 78.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|