C23H18BrNO4S — CID 4175391
2-(benzenesulfonyl)-3-[2-[(4-bromophenyl)methoxy]-3-methoxyphenyl]prop-2-enenitrile (PubChem CID 4175391) has the molecular formula C23H18BrNO4S and a molecular weight of 484.37 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-3-[2-[(4-bromophenyl)methoxy]-3-methoxyphenyl]prop-2-enenitrile.
| Compound Name | 2-(benzenesulfonyl)-3-[2-[(4-bromophenyl)methoxy]-3-methoxyphenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 4175391 |
| Molecular Formula | C23H18BrNO4S |
| Molecular Weight | 484.37 g/mol |
| Exact Mass | 483.01 |
| IUPAC Name | 2-(benzenesulfonyl)-3-[2-[(4-bromophenyl)methoxy]-3-methoxyphenyl]prop-2-enenitrile |
| SMILES | COc1cccc(C=C(C#N)S(=O)(=O)c2ccccc2)c1OCc1ccc(Br)cc1 |
| InChI | InChI=1S/C23H18BrNO4S/c1-28-22-9-5-6-18(23(22)29-16-17-10-12-19(24)13-11-17)14-21(15-25)30(26,27)20-7-3-2-4-8-20/h2-14H,16H2,1H3 |
| InChIKey | IYYOTSYNNRTEKR-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.37 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|