C27H27NO4S — CID 4178374
2-(benzenesulfonyl)-3-[2-[(4-tert-butylphenyl)methoxy]-3-methoxyphenyl]prop-2-enenitrile (PubChem CID 4178374) has the molecular formula C27H27NO4S and a molecular weight of 461.58 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-3-[2-[(4-tert-butylphenyl)methoxy]-3-methoxyphenyl]prop-2-enenitrile.
| Compound Name | 2-(benzenesulfonyl)-3-[2-[(4-tert-butylphenyl)methoxy]-3-methoxyphenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 4178374 |
| Molecular Formula | C27H27NO4S |
| Molecular Weight | 461.58 g/mol |
| Exact Mass | 461.17 |
| IUPAC Name | 2-(benzenesulfonyl)-3-[2-[(4-tert-butylphenyl)methoxy]-3-methoxyphenyl]prop-2-enenitrile |
| SMILES | COc1cccc(C=C(C#N)S(=O)(=O)c2ccccc2)c1OCc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C27H27NO4S/c1-27(2,3)22-15-13-20(14-16-22)19-32-26-21(9-8-12-25(26)31-4)17-24(18-28)33(29,30)23-10-6-5-7-11-23/h5-17H,19H2,1-4H3 |
| InChIKey | SPEJVBYNVJCVSB-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.58 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|