C29H34N2O3S — CID 4183013
1-[(3,5-dimethylphenoxy)methyl]-6,7-dimethoxy-N-(2-phenylethyl)-3,4-dihydro-1H-isoquinoline-2-carbothioamide (PubChem CID 4183013) has the molecular formula C29H34N2O3S and a molecular weight of 490.67 g/mol. Its IUPAC name is 1-[(3,5-dimethylphenoxy)methyl]-6,7-dimethoxy-N-(2-phenylethyl)-3,4-dihydro-1H-isoquinoline-2-carbothioamide.
| Compound Name | 1-[(3,5-dimethylphenoxy)methyl]-6,7-dimethoxy-N-(2-phenylethyl)-3,4-dihydro-1H-isoquinoline-2-carbothioamide |
|---|---|
| PubChem CID | 4183013 |
| Molecular Formula | C29H34N2O3S |
| Molecular Weight | 490.67 g/mol |
| Exact Mass | 490.23 |
| IUPAC Name | 1-[(3,5-dimethylphenoxy)methyl]-6,7-dimethoxy-N-(2-phenylethyl)-3,4-dihydro-1H-isoquinoline-2-carbothioamide |
| SMILES | COc1cc2c(cc1OC)C(COc1cc(C)cc(C)c1)N(C(=S)NCCc1ccccc1)CC2 |
| InChI | InChI=1S/C29H34N2O3S/c1-20-14-21(2)16-24(15-20)34-19-26-25-18-28(33-4)27(32-3)17-23(25)11-13-31(26)29(35)30-12-10-22-8-6-5-7-9-22/h5-9,14-18,26H,10-13,19H2,1-4H3,(H,30,35) |
| InChIKey | LEAWGOLKVWFKFQ-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.67 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|