C26H27FN2O3S — CID 3442048
N-benzyl-1-[(4-fluorophenoxy)methyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinoline-2-carbothioamide (PubChem CID 3442048) has the molecular formula C26H27FN2O3S and a molecular weight of 466.58 g/mol. Its IUPAC name is N-benzyl-1-[(4-fluorophenoxy)methyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinoline-2-carbothioamide.
| Compound Name | N-benzyl-1-[(4-fluorophenoxy)methyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinoline-2-carbothioamide |
|---|---|
| PubChem CID | 3442048 |
| Molecular Formula | C26H27FN2O3S |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | N-benzyl-1-[(4-fluorophenoxy)methyl]-6,7-dimethoxy-3,4-dihydro-1H-isoquinoline-2-carbothioamide |
| SMILES | COc1cc2c(cc1OC)C(COc1ccc(F)cc1)N(C(=S)NCc1ccccc1)CC2 |
| InChI | InChI=1S/C26H27FN2O3S/c1-30-24-14-19-12-13-29(26(33)28-16-18-6-4-3-5-7-18)23(22(19)15-25(24)31-2)17-32-21-10-8-20(27)9-11-21/h3-11,14-15,23H,12-13,16-17H2,1-2H3,(H,28,33) |
| InChIKey | ZBOHSTCKYXHASS-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|