C25H16ClN6+ — CID 4184635
1-amino-2-(1H-benzimidazol-2-yl)-3-(2-chlorophenyl)-5H-pyrido[1,2-a]benzimidazol-10-ium-4-carbonitrile (PubChem CID 4184635) has the molecular formula C25H16ClN6+ and a molecular weight of 435.90 g/mol. Its IUPAC name is 1-amino-2-(1H-benzimidazol-2-yl)-3-(2-chlorophenyl)-5H-pyrido[1,2-a]benzimidazol-10-ium-4-carbonitrile.
| Compound Name | 1-amino-2-(1H-benzimidazol-2-yl)-3-(2-chlorophenyl)-5H-pyrido[1,2-a]benzimidazol-10-ium-4-carbonitrile |
|---|---|
| PubChem CID | 4184635 |
| Molecular Formula | C25H16ClN6+ |
| Molecular Weight | 435.90 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | 1-amino-2-(1H-benzimidazol-2-yl)-3-(2-chlorophenyl)-5H-pyrido[1,2-a]benzimidazol-10-ium-4-carbonitrile |
| SMILES | N#Cc1c(-c2ccccc2Cl)c(-c2nc3ccccc3[nH]2)c(N)[n+]2c1[nH]c1ccccc12 |
| InChI | InChI=1S/C25H15ClN6/c26-16-8-2-1-7-14(16)21-15(13-27)25-31-19-11-5-6-12-20(19)32(25)23(28)22(21)24-29-17-9-3-4-10-18(17)30-24/h1-12H,(H3,28,29,30,31)/p+1 |
| InChIKey | ITYAONAKIIQKAF-UHFFFAOYSA-O |
| XLogP | 5.22 |
| TPSA | 98.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.90 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|