C13H6ClF3N2 — CID 168555540
2-(4-chloro-2,3,6-trifluorophenyl)-1H-benzimidazole (PubChem CID 168555540) has the molecular formula C13H6ClF3N2 and a molecular weight of 282.65 g/mol. Its IUPAC name is 2-(4-chloro-2,3,6-trifluorophenyl)-1H-benzimidazole.
| Compound Name | 2-(4-chloro-2,3,6-trifluorophenyl)-1H-benzimidazole |
|---|---|
| PubChem CID | 168555540 |
| Molecular Formula | C13H6ClF3N2 |
| Molecular Weight | 282.65 g/mol |
| Exact Mass | 282.02 |
| IUPAC Name | 2-(4-chloro-2,3,6-trifluorophenyl)-1H-benzimidazole |
| SMILES | Fc1cc(Cl)c(F)c(F)c1-c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C13H6ClF3N2/c14-6-5-7(15)10(12(17)11(6)16)13-18-8-3-1-2-4-9(8)19-13/h1-5H,(H,18,19) |
| InChIKey | VEQYXPDBPBONBI-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.65 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|