C13H9F2N3 — CID 168555282
6-(1H-benzimidazol-2-yl)-2,3-difluoroaniline (PubChem CID 168555282) has the molecular formula C13H9F2N3 and a molecular weight of 245.23 g/mol. Its IUPAC name is 6-(1H-benzimidazol-2-yl)-2,3-difluoroaniline.
| Compound Name | 6-(1H-benzimidazol-2-yl)-2,3-difluoroaniline |
|---|---|
| PubChem CID | 168555282 |
| Molecular Formula | C13H9F2N3 |
| Molecular Weight | 245.23 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | 6-(1H-benzimidazol-2-yl)-2,3-difluoroaniline |
| SMILES | Nc1c(-c2nc3ccccc3[nH]2)ccc(F)c1F |
| InChI | InChI=1S/C13H9F2N3/c14-8-6-5-7(12(16)11(8)15)13-17-9-3-1-2-4-10(9)18-13/h1-6H,16H2,(H,17,18) |
| InChIKey | YWIXJGZKAUMLPG-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.23 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|