C23H18ClN3O6S2 — CID 4189006
2-[5-[(2-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-[4-(furan-2-ylmethylsulfamoyl)phenyl]acetamide (PubChem CID 4189006) has the molecular formula C23H18ClN3O6S2 and a molecular weight of 532.00 g/mol. Its IUPAC name is 2-[5-[(2-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-[4-(furan-2-ylmethylsulfamoyl)phenyl]acetamide.
| Compound Name | 2-[5-[(2-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-[4-(furan-2-ylmethylsulfamoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 4189006 |
| Molecular Formula | C23H18ClN3O6S2 |
| Molecular Weight | 532.00 g/mol |
| Exact Mass | 531.03 |
| IUPAC Name | 2-[5-[(2-chlorophenyl)methylidene]-2,4-dioxo-1,3-thiazolidin-3-yl]-N-[4-(furan-2-ylmethylsulfamoyl)phenyl]acetamide |
| SMILES | O=C(CN1C(=O)SC(=Cc2ccccc2Cl)C1=O)Nc1ccc(S(=O)(=O)NCc2ccco2)cc1 |
| InChI | InChI=1S/C23H18ClN3O6S2/c24-19-6-2-1-4-15(19)12-20-22(29)27(23(30)34-20)14-21(28)26-16-7-9-18(10-8-16)35(31,32)25-13-17-5-3-11-33-17/h1-12,25H,13-14H2,(H,26,28) |
| InChIKey | ODUIYOGSYIOMCW-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 125.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.00 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|