C33H29BrCl2N2O7 — CID 4189142
8-(bromomethyl)-6a,9a-dichloro-2-(4-ethenylphenyl)-6-[2-(4-hydroxy-3,5-dimethoxyphenyl)ethenyl]-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 4189142) has the molecular formula C33H29BrCl2N2O7 and a molecular weight of 716.41 g/mol. Its IUPAC name is 8-(bromomethyl)-6a,9a-dichloro-2-(4-ethenylphenyl)-6-[2-(4-hydroxy-3,5-dimethoxyphenyl)ethenyl]-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 8-(bromomethyl)-6a,9a-dichloro-2-(4-ethenylphenyl)-6-[2-(4-hydroxy-3,5-dimethoxyphenyl)ethenyl]-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 4189142 |
| Molecular Formula | C33H29BrCl2N2O7 |
| Molecular Weight | 716.41 g/mol |
| Exact Mass | 714.05 |
| IUPAC Name | 8-(bromomethyl)-6a,9a-dichloro-2-(4-ethenylphenyl)-6-[2-(4-hydroxy-3,5-dimethoxyphenyl)ethenyl]-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | C=Cc1ccc(N2C(=O)C3CC=C4C(CC5(Cl)C(=O)N(CBr)C(=O)C5(Cl)C4C=Cc4cc(OC)c(O)c(OC)c4)C3C2=O)cc1 |
| InChI | InChI=1S/C33H29BrCl2N2O7/c1-4-17-5-8-19(9-6-17)38-28(40)21-11-10-20-22(26(21)29(38)41)15-32(35)30(42)37(16-34)31(43)33(32,36)23(20)12-7-18-13-24(44-2)27(39)25(14-18)45-3/h4-10,12-14,21-23,26,39H,1,11,15-16H2,2-3H3 |
| InChIKey | VWYWWVIMIMYWOT-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 113.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.41 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|