C38H31BrCl2N2O8 — CID 4656527
2-(4-benzoylphenyl)-8-(bromomethyl)-6a,9a-dichloro-6-[2-(4-hydroxy-3,5-dimethoxyphenyl)ethenyl]-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone (PubChem CID 4656527) has the molecular formula C38H31BrCl2N2O8 and a molecular weight of 794.48 g/mol. Its IUPAC name is 2-(4-benzoylphenyl)-8-(bromomethyl)-6a,9a-dichloro-6-[2-(4-hydroxy-3,5-dimethoxyphenyl)ethenyl]-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone.
| Compound Name | 2-(4-benzoylphenyl)-8-(bromomethyl)-6a,9a-dichloro-6-[2-(4-hydroxy-3,5-dimethoxyphenyl)ethenyl]-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
|---|---|
| PubChem CID | 4656527 |
| Molecular Formula | C38H31BrCl2N2O8 |
| Molecular Weight | 794.48 g/mol |
| Exact Mass | 792.06 |
| IUPAC Name | 2-(4-benzoylphenyl)-8-(bromomethyl)-6a,9a-dichloro-6-[2-(4-hydroxy-3,5-dimethoxyphenyl)ethenyl]-3a,4,6,10,10a,10b-hexahydroisoindolo[5,6-e]isoindole-1,3,7,9-tetrone |
| SMILES | COc1cc(C=CC2C3=CCC4C(=O)N(c5ccc(C(=O)c6ccccc6)cc5)C(=O)C4C3CC3(Cl)C(=O)N(CBr)C(=O)C23Cl)cc(OC)c1O |
| InChI | InChI=1S/C38H31BrCl2N2O8/c1-50-28-16-20(17-29(51-2)32(28)45)8-15-27-24-13-14-25-30(26(24)18-37(40)35(48)42(19-39)36(49)38(27,37)41)34(47)43(33(25)46)23-11-9-22(10-12-23)31(44)21-6-4-3-5-7-21/h3-13,15-17,25-27,30,45H,14,18-19H2,1-2H3 |
| InChIKey | XJGIIYMRZMNTPS-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 130.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.48 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|