C27H30ClN3O6S2 — CID 4190352
N-[5-(azepan-1-ylsulfonyl)-2-chlorophenyl]-2-[(4-ethoxyphenyl)sulfonylamino]benzamide (PubChem CID 4190352) has the molecular formula C27H30ClN3O6S2 and a molecular weight of 592.14 g/mol. Its IUPAC name is N-[5-(azepan-1-ylsulfonyl)-2-chlorophenyl]-2-[(4-ethoxyphenyl)sulfonylamino]benzamide.
| Compound Name | N-[5-(azepan-1-ylsulfonyl)-2-chlorophenyl]-2-[(4-ethoxyphenyl)sulfonylamino]benzamide |
|---|---|
| PubChem CID | 4190352 |
| Molecular Formula | C27H30ClN3O6S2 |
| Molecular Weight | 592.14 g/mol |
| Exact Mass | 591.13 |
| IUPAC Name | N-[5-(azepan-1-ylsulfonyl)-2-chlorophenyl]-2-[(4-ethoxyphenyl)sulfonylamino]benzamide |
| SMILES | CCOc1ccc(S(=O)(=O)Nc2ccccc2C(=O)Nc2cc(S(=O)(=O)N3CCCCCC3)ccc2Cl)cc1 |
| InChI | InChI=1S/C27H30ClN3O6S2/c1-2-37-20-11-13-21(14-12-20)38(33,34)30-25-10-6-5-9-23(25)27(32)29-26-19-22(15-16-24(26)28)39(35,36)31-17-7-3-4-8-18-31/h5-6,9-16,19,30H,2-4,7-8,17-18H2,1H3,(H,29,32) |
| InChIKey | OBVOBYKPNHCCRD-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.14 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |