C26H18N8O6 — CID 4198222
N-[2-methyl-4-[3-methyl-4-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]phenyl]phenyl]-4-nitro-2,1,3-benzoxadiazol-7-amine (PubChem CID 4198222) has the molecular formula C26H18N8O6 and a molecular weight of 538.48 g/mol. Its IUPAC name is N-[2-methyl-4-[3-methyl-4-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]phenyl]phenyl]-4-nitro-2,1,3-benzoxadiazol-7-amine.
| Compound Name | N-[2-methyl-4-[3-methyl-4-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]phenyl]phenyl]-4-nitro-2,1,3-benzoxadiazol-7-amine |
|---|---|
| PubChem CID | 4198222 |
| Molecular Formula | C26H18N8O6 |
| Molecular Weight | 538.48 g/mol |
| Exact Mass | 538.13 |
| IUPAC Name | N-[2-methyl-4-[3-methyl-4-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]phenyl]phenyl]-4-nitro-2,1,3-benzoxadiazol-7-amine |
| SMILES | Cc1cc(-c2ccc(Nc3ccc([N+](=O)[O-])c4nonc34)c(C)c2)ccc1Nc1ccc([N+](=O)[O-])c2nonc12 |
| InChI | InChI=1S/C26H18N8O6/c1-13-11-15(3-5-17(13)27-19-7-9-21(33(35)36)25-23(19)29-39-31-25)16-4-6-18(14(2)12-16)28-20-8-10-22(34(37)38)26-24(20)30-40-32-26/h3-12,27-28H,1-2H3 |
| InChIKey | JALQJXUGEJNWHR-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 188.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.48 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|