C20H21NO4S — CID 42021987
2-(5,6-dimethyl-1-benzofuran-3-yl)-N-(4-ethylsulfonylphenyl)acetamide (PubChem CID 42021987) has the molecular formula C20H21NO4S and a molecular weight of 371.46 g/mol. Its IUPAC name is 2-(5,6-dimethyl-1-benzofuran-3-yl)-N-(4-ethylsulfonylphenyl)acetamide.
| Compound Name | 2-(5,6-dimethyl-1-benzofuran-3-yl)-N-(4-ethylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 42021987 |
| Molecular Formula | C20H21NO4S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | 2-(5,6-dimethyl-1-benzofuran-3-yl)-N-(4-ethylsulfonylphenyl)acetamide |
| SMILES | CCS(=O)(=O)c1ccc(NC(=O)Cc2coc3cc(C)c(C)cc23)cc1 |
| InChI | InChI=1S/C20H21NO4S/c1-4-26(23,24)17-7-5-16(6-8-17)21-20(22)11-15-12-25-19-10-14(3)13(2)9-18(15)19/h5-10,12H,4,11H2,1-3H3,(H,21,22) |
| InChIKey | CVICVURYQBSBDO-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |