C24H30N2O4S — CID 2513771
N-[4-(diethylsulfamoyl)phenyl]-2-(6-methyl-5-propan-2-yl-1-benzofuran-3-yl)acetamide (PubChem CID 2513771) has the molecular formula C24H30N2O4S and a molecular weight of 442.58 g/mol. Its IUPAC name is N-[4-(diethylsulfamoyl)phenyl]-2-(6-methyl-5-propan-2-yl-1-benzofuran-3-yl)acetamide.
| Compound Name | N-[4-(diethylsulfamoyl)phenyl]-2-(6-methyl-5-propan-2-yl-1-benzofuran-3-yl)acetamide |
|---|---|
| PubChem CID | 2513771 |
| Molecular Formula | C24H30N2O4S |
| Molecular Weight | 442.58 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | N-[4-(diethylsulfamoyl)phenyl]-2-(6-methyl-5-propan-2-yl-1-benzofuran-3-yl)acetamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(NC(=O)Cc2coc3cc(C)c(C(C)C)cc23)cc1 |
| InChI | InChI=1S/C24H30N2O4S/c1-6-26(7-2)31(28,29)20-10-8-19(9-11-20)25-24(27)13-18-15-30-23-12-17(5)21(16(3)4)14-22(18)23/h8-12,14-16H,6-7,13H2,1-5H3,(H,25,27) |
| InChIKey | KZYRSTOTGOALJE-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.58 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |