C23H27NO4S — CID 55433162
2-(6-methyl-5-propan-2-yl-1-benzofuran-3-yl)-N-[1-(4-methylsulfonylphenyl)ethyl]acetamide (PubChem CID 55433162) has the molecular formula C23H27NO4S and a molecular weight of 413.54 g/mol. Its IUPAC name is 2-(6-methyl-5-propan-2-yl-1-benzofuran-3-yl)-N-[1-(4-methylsulfonylphenyl)ethyl]acetamide.
| Compound Name | 2-(6-methyl-5-propan-2-yl-1-benzofuran-3-yl)-N-[1-(4-methylsulfonylphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 55433162 |
| Molecular Formula | C23H27NO4S |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | 2-(6-methyl-5-propan-2-yl-1-benzofuran-3-yl)-N-[1-(4-methylsulfonylphenyl)ethyl]acetamide |
| SMILES | Cc1cc2occ(CC(=O)NC(C)c3ccc(S(C)(=O)=O)cc3)c2cc1C(C)C |
| InChI | InChI=1S/C23H27NO4S/c1-14(2)20-12-21-18(13-28-22(21)10-15(20)3)11-23(25)24-16(4)17-6-8-19(9-7-17)29(5,26)27/h6-10,12-14,16H,11H2,1-5H3,(H,24,25) |
| InChIKey | QDUYAMWYENAEDO-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |