C19H21N3O2 — CID 4202721
3-(1-tert-butyl-2,5-dimethylpyrrol-3-yl)-2-(3-nitrophenyl)prop-2-enenitrile (PubChem CID 4202721) has the molecular formula C19H21N3O2 and a molecular weight of 323.40 g/mol. Its IUPAC name is 3-(1-tert-butyl-2,5-dimethylpyrrol-3-yl)-2-(3-nitrophenyl)prop-2-enenitrile.
| Compound Name | 3-(1-tert-butyl-2,5-dimethylpyrrol-3-yl)-2-(3-nitrophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 4202721 |
| Molecular Formula | C19H21N3O2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | 3-(1-tert-butyl-2,5-dimethylpyrrol-3-yl)-2-(3-nitrophenyl)prop-2-enenitrile |
| SMILES | Cc1cc(C=C(C#N)c2cccc([N+](=O)[O-])c2)c(C)n1C(C)(C)C |
| InChI | InChI=1S/C19H21N3O2/c1-13-9-16(14(2)21(13)19(3,4)5)10-17(12-20)15-7-6-8-18(11-15)22(23)24/h6-11H,1-5H3 |
| InChIKey | AFRUOQZBKKYJTB-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 71.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|