C12H14IN3O2 — CID 4203083
5-(4-ethoxy-3-methoxyphenyl)-4-iodo-1H-pyrazol-3-amine (PubChem CID 4203083) has the molecular formula C12H14IN3O2 and a molecular weight of 359.17 g/mol. Its IUPAC name is 5-(4-ethoxy-3-methoxyphenyl)-4-iodo-1H-pyrazol-3-amine.
| Compound Name | 5-(4-ethoxy-3-methoxyphenyl)-4-iodo-1H-pyrazol-3-amine |
|---|---|
| PubChem CID | 4203083 |
| Molecular Formula | C12H14IN3O2 |
| Molecular Weight | 359.17 g/mol |
| Exact Mass | 359.01 |
| IUPAC Name | 5-(4-ethoxy-3-methoxyphenyl)-4-iodo-1H-pyrazol-3-amine |
| SMILES | CCOc1ccc(-c2[nH]nc(N)c2I)cc1OC |
| InChI | InChI=1S/C12H14IN3O2/c1-3-18-8-5-4-7(6-9(8)17-2)11-10(13)12(14)16-15-11/h4-6H,3H2,1-2H3,(H3,14,15,16) |
| InChIKey | HUPRXOGFKYVBFD-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 73.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.17 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|