C17H21BrN2O2S — CID 42032877
6-bromo-3-(2-methylpropyl)-2-[[(2R)-oxolan-2-yl]methylsulfanyl]quinazolin-4-one (PubChem CID 42032877) has the molecular formula C17H21BrN2O2S and a molecular weight of 397.34 g/mol. Its IUPAC name is 6-bromo-3-(2-methylpropyl)-2-[[(2R)-oxolan-2-yl]methylsulfanyl]quinazolin-4-one.
| Compound Name | 6-bromo-3-(2-methylpropyl)-2-[[(2R)-oxolan-2-yl]methylsulfanyl]quinazolin-4-one |
|---|---|
| PubChem CID | 42032877 |
| Molecular Formula | C17H21BrN2O2S |
| Molecular Weight | 397.34 g/mol |
| Exact Mass | 396.05 |
| IUPAC Name | 6-bromo-3-(2-methylpropyl)-2-[[(2R)-oxolan-2-yl]methylsulfanyl]quinazolin-4-one |
| SMILES | CC(C)Cn1c(SC[C@H]2CCCO2)nc2ccc(Br)cc2c1=O |
| InChI | InChI=1S/C17H21BrN2O2S/c1-11(2)9-20-16(21)14-8-12(18)5-6-15(14)19-17(20)23-10-13-4-3-7-22-13/h5-6,8,11,13H,3-4,7,9-10H2,1-2H3/t13-/m1/s1 |
| InChIKey | WAYGBROEHVSAQA-CYBMUJFWSA-N |
| XLogP | 4.09 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.34 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |