C11H22N2O4 — CID 4204339
methyl 2-(ethylcarbamoylamino)-3-[(2-methylpropan-2-yl)oxy]propanoate (PubChem CID 4204339) has the molecular formula C11H22N2O4 and a molecular weight of 246.31 g/mol. Its IUPAC name is methyl 2-(ethylcarbamoylamino)-3-[(2-methylpropan-2-yl)oxy]propanoate.
| Compound Name | methyl 2-(ethylcarbamoylamino)-3-[(2-methylpropan-2-yl)oxy]propanoate |
|---|---|
| PubChem CID | 4204339 |
| Molecular Formula | C11H22N2O4 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | methyl 2-(ethylcarbamoylamino)-3-[(2-methylpropan-2-yl)oxy]propanoate |
| SMILES | CCNC(=O)NC(COC(C)(C)C)C(=O)OC |
| InChI | InChI=1S/C11H22N2O4/c1-6-12-10(15)13-8(9(14)16-5)7-17-11(2,3)4/h8H,6-7H2,1-5H3,(H2,12,13,15) |
| InChIKey | USRPGGQPWKFLOB-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |