C19H21Cl2N3O3S — CID 42069796
2-(2,3-dichloroanilino)-N-(4-piperidin-1-ylsulfonylphenyl)acetamide (PubChem CID 42069796) has the molecular formula C19H21Cl2N3O3S and a molecular weight of 442.37 g/mol. Its IUPAC name is 2-(2,3-dichloroanilino)-N-(4-piperidin-1-ylsulfonylphenyl)acetamide.
| Compound Name | 2-(2,3-dichloroanilino)-N-(4-piperidin-1-ylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 42069796 |
| Molecular Formula | C19H21Cl2N3O3S |
| Molecular Weight | 442.37 g/mol |
| Exact Mass | 441.07 |
| IUPAC Name | 2-(2,3-dichloroanilino)-N-(4-piperidin-1-ylsulfonylphenyl)acetamide |
| SMILES | O=C(CNc1cccc(Cl)c1Cl)Nc1ccc(S(=O)(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C19H21Cl2N3O3S/c20-16-5-4-6-17(19(16)21)22-13-18(25)23-14-7-9-15(10-8-14)28(26,27)24-11-2-1-3-12-24/h4-10,22H,1-3,11-13H2,(H,23,25) |
| InChIKey | YNBMYTBCNATJTB-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.37 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |