C21H27N3O3S — CID 9080738
2-(2,3-dimethylanilino)-N-(4-piperidin-1-ylsulfonylphenyl)acetamide (PubChem CID 9080738) has the molecular formula C21H27N3O3S and a molecular weight of 401.53 g/mol. Its IUPAC name is 2-(2,3-dimethylanilino)-N-(4-piperidin-1-ylsulfonylphenyl)acetamide.
| Compound Name | 2-(2,3-dimethylanilino)-N-(4-piperidin-1-ylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 9080738 |
| Molecular Formula | C21H27N3O3S |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | 2-(2,3-dimethylanilino)-N-(4-piperidin-1-ylsulfonylphenyl)acetamide |
| SMILES | Cc1cccc(NCC(=O)Nc2ccc(S(=O)(=O)N3CCCCC3)cc2)c1C |
| InChI | InChI=1S/C21H27N3O3S/c1-16-7-6-8-20(17(16)2)22-15-21(25)23-18-9-11-19(12-10-18)28(26,27)24-13-4-3-5-14-24/h6-12,22H,3-5,13-15H2,1-2H3,(H,23,25) |
| InChIKey | IJHLCKBBSZQRDI-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |