C10H13ClN4O4S — CID 4207319
2-[(4-chlorophenyl)sulfonylamino]-N-(2-hydrazinyl-2-oxoethyl)acetamide (PubChem CID 4207319) has the molecular formula C10H13ClN4O4S and a molecular weight of 320.76 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)sulfonylamino]-N-(2-hydrazinyl-2-oxoethyl)acetamide.
| Compound Name | 2-[(4-chlorophenyl)sulfonylamino]-N-(2-hydrazinyl-2-oxoethyl)acetamide |
|---|---|
| PubChem CID | 4207319 |
| Molecular Formula | C10H13ClN4O4S |
| Molecular Weight | 320.76 g/mol |
| Exact Mass | 320.03 |
| IUPAC Name | 2-[(4-chlorophenyl)sulfonylamino]-N-(2-hydrazinyl-2-oxoethyl)acetamide |
| SMILES | NNC(=O)CNC(=O)CNS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C10H13ClN4O4S/c11-7-1-3-8(4-2-7)20(18,19)14-6-9(16)13-5-10(17)15-12/h1-4,14H,5-6,12H2,(H,13,16)(H,15,17) |
| InChIKey | UDOFVLXAEFWGMM-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 130.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.76 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|