C22H32N4O2 — CID 42095648
(3R)-4-(3-methylbut-2-enyl)-3-[2-[4-(2-methylphenyl)piperazin-1-yl]-2-oxoethyl]piperazin-2-one (PubChem CID 42095648) has the molecular formula C22H32N4O2 and a molecular weight of 384.52 g/mol. Its IUPAC name is (3R)-4-(3-methylbut-2-enyl)-3-[2-[4-(2-methylphenyl)piperazin-1-yl]-2-oxoethyl]piperazin-2-one.
| Compound Name | (3R)-4-(3-methylbut-2-enyl)-3-[2-[4-(2-methylphenyl)piperazin-1-yl]-2-oxoethyl]piperazin-2-one |
|---|---|
| PubChem CID | 42095648 |
| Molecular Formula | C22H32N4O2 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.25 |
| IUPAC Name | (3R)-4-(3-methylbut-2-enyl)-3-[2-[4-(2-methylphenyl)piperazin-1-yl]-2-oxoethyl]piperazin-2-one |
| SMILES | CC(C)=CCN1CCNC(=O)[C@H]1CC(=O)N1CCN(c2ccccc2C)CC1 |
| InChI | InChI=1S/C22H32N4O2/c1-17(2)8-10-24-11-9-23-22(28)20(24)16-21(27)26-14-12-25(13-15-26)19-7-5-4-6-18(19)3/h4-8,20H,9-16H2,1-3H3,(H,23,28)/t20-/m1/s1 |
| InChIKey | UDQPFVWYMUFABR-HXUWFJFHSA-N |
| XLogP | 1.80 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|