C17H16N2O2S2 — CID 42104105
(2R)-1-(4-phenylphenoxy)-3-(1,3,4-thiadiazol-2-ylsulfanyl)propan-2-ol (PubChem CID 42104105) has the molecular formula C17H16N2O2S2 and a molecular weight of 344.46 g/mol. Its IUPAC name is (2R)-1-(4-phenylphenoxy)-3-(1,3,4-thiadiazol-2-ylsulfanyl)propan-2-ol.
| Compound Name | (2R)-1-(4-phenylphenoxy)-3-(1,3,4-thiadiazol-2-ylsulfanyl)propan-2-ol |
|---|---|
| PubChem CID | 42104105 |
| Molecular Formula | C17H16N2O2S2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | (2R)-1-(4-phenylphenoxy)-3-(1,3,4-thiadiazol-2-ylsulfanyl)propan-2-ol |
| SMILES | O[C@H](COc1ccc(-c2ccccc2)cc1)CSc1nncs1 |
| InChI | InChI=1S/C17H16N2O2S2/c20-15(11-22-17-19-18-12-23-17)10-21-16-8-6-14(7-9-16)13-4-2-1-3-5-13/h1-9,12,15,20H,10-11H2/t15-/m1/s1 |
| InChIKey | ALWSMNACSOTSMW-OAHLLOKOSA-N |
| XLogP | 3.74 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |