C12H14N2O2S2 — CID 60670624
1-phenylmethoxy-3-(1,3,4-thiadiazol-2-ylsulfanyl)propan-2-ol (PubChem CID 60670624) has the molecular formula C12H14N2O2S2 and a molecular weight of 282.39 g/mol. Its IUPAC name is 1-phenylmethoxy-3-(1,3,4-thiadiazol-2-ylsulfanyl)propan-2-ol.
| Compound Name | 1-phenylmethoxy-3-(1,3,4-thiadiazol-2-ylsulfanyl)propan-2-ol |
|---|---|
| PubChem CID | 60670624 |
| Molecular Formula | C12H14N2O2S2 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | 1-phenylmethoxy-3-(1,3,4-thiadiazol-2-ylsulfanyl)propan-2-ol |
| SMILES | OC(COCc1ccccc1)CSc1nncs1 |
| InChI | InChI=1S/C12H14N2O2S2/c15-11(8-17-12-14-13-9-18-12)7-16-6-10-4-2-1-3-5-10/h1-5,9,11,15H,6-8H2 |
| InChIKey | AABUZIHWYOIZNH-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |