C19H19F2N3O6S — CID 42118830
[2-(difluoromethoxy)phenyl]-[4-(4-methylsulfonyl-2-nitrophenyl)piperazin-1-yl]methanone (PubChem CID 42118830) has the molecular formula C19H19F2N3O6S and a molecular weight of 455.44 g/mol. Its IUPAC name is [2-(difluoromethoxy)phenyl]-[4-(4-methylsulfonyl-2-nitrophenyl)piperazin-1-yl]methanone.
| Compound Name | [2-(difluoromethoxy)phenyl]-[4-(4-methylsulfonyl-2-nitrophenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 42118830 |
| Molecular Formula | C19H19F2N3O6S |
| Molecular Weight | 455.44 g/mol |
| Exact Mass | 455.10 |
| IUPAC Name | [2-(difluoromethoxy)phenyl]-[4-(4-methylsulfonyl-2-nitrophenyl)piperazin-1-yl]methanone |
| SMILES | CS(=O)(=O)c1ccc(N2CCN(C(=O)c3ccccc3OC(F)F)CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H19F2N3O6S/c1-31(28,29)13-6-7-15(16(12-13)24(26)27)22-8-10-23(11-9-22)18(25)14-4-2-3-5-17(14)30-19(20)21/h2-7,12,19H,8-11H2,1H3 |
| InChIKey | KTDMDDGQDWDEMK-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 110.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.44 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|