C19H19F3N4O6S — CID 46478683
[4-(4-methylsulfonyl-2-nitrophenyl)piperazin-1-yl]-[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methanone (PubChem CID 46478683) has the molecular formula C19H19F3N4O6S and a molecular weight of 488.44 g/mol. Its IUPAC name is [4-(4-methylsulfonyl-2-nitrophenyl)piperazin-1-yl]-[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methanone.
| Compound Name | [4-(4-methylsulfonyl-2-nitrophenyl)piperazin-1-yl]-[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methanone |
|---|---|
| PubChem CID | 46478683 |
| Molecular Formula | C19H19F3N4O6S |
| Molecular Weight | 488.44 g/mol |
| Exact Mass | 488.10 |
| IUPAC Name | [4-(4-methylsulfonyl-2-nitrophenyl)piperazin-1-yl]-[2-(2,2,2-trifluoroethoxy)-3-pyridinyl]methanone |
| SMILES | CS(=O)(=O)c1ccc(N2CCN(C(=O)c3cccnc3OCC(F)(F)F)CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H19F3N4O6S/c1-33(30,31)13-4-5-15(16(11-13)26(28)29)24-7-9-25(10-8-24)18(27)14-3-2-6-23-17(14)32-12-19(20,21)22/h2-6,11H,7-10,12H2,1H3 |
| InChIKey | YVFDVCCYMQSOIL-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 122.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.44 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|