C28H20N4O4 — CID 4212958
1-(3,5-dimethoxyphenyl)-3-[2-(4-nitrophenyl)ethenyl]pyrido[1,2-a]benzimidazole-4-carbonitrile (PubChem CID 4212958) has the molecular formula C28H20N4O4 and a molecular weight of 476.49 g/mol. Its IUPAC name is 1-(3,5-dimethoxyphenyl)-3-[2-(4-nitrophenyl)ethenyl]pyrido[1,2-a]benzimidazole-4-carbonitrile.
| Compound Name | 1-(3,5-dimethoxyphenyl)-3-[2-(4-nitrophenyl)ethenyl]pyrido[1,2-a]benzimidazole-4-carbonitrile |
|---|---|
| PubChem CID | 4212958 |
| Molecular Formula | C28H20N4O4 |
| Molecular Weight | 476.49 g/mol |
| Exact Mass | 476.15 |
| IUPAC Name | 1-(3,5-dimethoxyphenyl)-3-[2-(4-nitrophenyl)ethenyl]pyrido[1,2-a]benzimidazole-4-carbonitrile |
| SMILES | COc1cc(OC)cc(-c2cc(C=Cc3ccc([N+](=O)[O-])cc3)c(C#N)c3nc4ccccc4n23)c1 |
| InChI | InChI=1S/C28H20N4O4/c1-35-22-13-20(14-23(16-22)36-2)27-15-19(10-7-18-8-11-21(12-9-18)32(33)34)24(17-29)28-30-25-5-3-4-6-26(25)31(27)28/h3-16H,1-2H3 |
| InChIKey | DACBTYZJHZAVGY-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 102.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.49 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|