C17H14Cl3NO3S — CID 4213505
[2-oxo-2-(2,4,5-trichloroanilino)ethyl] 4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylate (PubChem CID 4213505) has the molecular formula C17H14Cl3NO3S and a molecular weight of 418.73 g/mol. Its IUPAC name is [2-oxo-2-(2,4,5-trichloroanilino)ethyl] 4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylate.
| Compound Name | [2-oxo-2-(2,4,5-trichloroanilino)ethyl] 4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 4213505 |
| Molecular Formula | C17H14Cl3NO3S |
| Molecular Weight | 418.73 g/mol |
| Exact Mass | 416.98 |
| IUPAC Name | [2-oxo-2-(2,4,5-trichloroanilino)ethyl] 4,5,6,7-tetrahydro-1-benzothiophene-2-carboxylate |
| SMILES | O=C(COC(=O)c1cc2c(s1)CCCC2)Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C17H14Cl3NO3S/c18-10-6-12(20)13(7-11(10)19)21-16(22)8-24-17(23)15-5-9-3-1-2-4-14(9)25-15/h5-7H,1-4,8H2,(H,21,22) |
| InChIKey | UIENPXCCFPRMAW-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.73 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|