C16H13ClN2O5S — CID 7623584
[2-(5-chloro-2-nitroanilino)-2-oxoethyl] 5,6-dihydro-4H-cyclopenta[b]thiophene-2-carboxylate (PubChem CID 7623584) has the molecular formula C16H13ClN2O5S and a molecular weight of 380.81 g/mol. Its IUPAC name is [2-(5-chloro-2-nitroanilino)-2-oxoethyl] 5,6-dihydro-4H-cyclopenta[b]thiophene-2-carboxylate.
| Compound Name | [2-(5-chloro-2-nitroanilino)-2-oxoethyl] 5,6-dihydro-4H-cyclopenta[b]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 7623584 |
| Molecular Formula | C16H13ClN2O5S |
| Molecular Weight | 380.81 g/mol |
| Exact Mass | 380.02 |
| IUPAC Name | [2-(5-chloro-2-nitroanilino)-2-oxoethyl] 5,6-dihydro-4H-cyclopenta[b]thiophene-2-carboxylate |
| SMILES | O=C(COC(=O)c1cc2c(s1)CCC2)Nc1cc(Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H13ClN2O5S/c17-10-4-5-12(19(22)23)11(7-10)18-15(20)8-24-16(21)14-6-9-2-1-3-13(9)25-14/h4-7H,1-3,8H2,(H,18,20) |
| InChIKey | VYSRZDYUBSRQIJ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.81 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|