C23H27F3N2O2 — CID 42147497
N-benzyl-3-[1-[(2R)-4,4,4-trifluorobutan-2-yl]piperidin-4-yl]oxybenzamide (PubChem CID 42147497) has the molecular formula C23H27F3N2O2 and a molecular weight of 420.48 g/mol. Its IUPAC name is N-benzyl-3-[1-[(2R)-4,4,4-trifluorobutan-2-yl]piperidin-4-yl]oxybenzamide.
| Compound Name | N-benzyl-3-[1-[(2R)-4,4,4-trifluorobutan-2-yl]piperidin-4-yl]oxybenzamide |
|---|---|
| PubChem CID | 42147497 |
| Molecular Formula | C23H27F3N2O2 |
| Molecular Weight | 420.48 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | N-benzyl-3-[1-[(2R)-4,4,4-trifluorobutan-2-yl]piperidin-4-yl]oxybenzamide |
| SMILES | C[C@H](CC(F)(F)F)N1CCC(Oc2cccc(C(=O)NCc3ccccc3)c2)CC1 |
| InChI | InChI=1S/C23H27F3N2O2/c1-17(15-23(24,25)26)28-12-10-20(11-13-28)30-21-9-5-8-19(14-21)22(29)27-16-18-6-3-2-4-7-18/h2-9,14,17,20H,10-13,15-16H2,1H3,(H,27,29)/t17-/m1/s1 |
| InChIKey | MJMMOLQVEVYWLQ-QGZVFWFLSA-N |
| XLogP | 4.80 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.48 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |