C25H32N2O3 — CID 25307703
[3-[1-[(2S)-1-phenoxypropan-2-yl]piperidin-4-yl]oxyphenyl]-pyrrolidin-1-ylmethanone (PubChem CID 25307703) has the molecular formula C25H32N2O3 and a molecular weight of 408.54 g/mol. Its IUPAC name is [3-[1-[(2S)-1-phenoxypropan-2-yl]piperidin-4-yl]oxyphenyl]-pyrrolidin-1-ylmethanone.
| Compound Name | [3-[1-[(2S)-1-phenoxypropan-2-yl]piperidin-4-yl]oxyphenyl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 25307703 |
| Molecular Formula | C25H32N2O3 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.24 |
| IUPAC Name | [3-[1-[(2S)-1-phenoxypropan-2-yl]piperidin-4-yl]oxyphenyl]-pyrrolidin-1-ylmethanone |
| SMILES | C[C@@H](COc1ccccc1)N1CCC(Oc2cccc(C(=O)N3CCCC3)c2)CC1 |
| InChI | InChI=1S/C25H32N2O3/c1-20(19-29-22-9-3-2-4-10-22)26-16-12-23(13-17-26)30-24-11-7-8-21(18-24)25(28)27-14-5-6-15-27/h2-4,7-11,18,20,23H,5-6,12-17,19H2,1H3/t20-/m0/s1 |
| InChIKey | NAELFVMSQQKCIW-FQEVSTJZSA-N |
| XLogP | 4.23 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |