C26H34N2O4 — CID 45229358
[4-methoxy-2-[1-(1-phenoxypropan-2-yl)piperidin-4-yl]oxyphenyl]-pyrrolidin-1-ylmethanone (PubChem CID 45229358) has the molecular formula C26H34N2O4 and a molecular weight of 438.57 g/mol. Its IUPAC name is [4-methoxy-2-[1-(1-phenoxypropan-2-yl)piperidin-4-yl]oxyphenyl]-pyrrolidin-1-ylmethanone.
| Compound Name | [4-methoxy-2-[1-(1-phenoxypropan-2-yl)piperidin-4-yl]oxyphenyl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 45229358 |
| Molecular Formula | C26H34N2O4 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.25 |
| IUPAC Name | [4-methoxy-2-[1-(1-phenoxypropan-2-yl)piperidin-4-yl]oxyphenyl]-pyrrolidin-1-ylmethanone |
| SMILES | COc1ccc(C(=O)N2CCCC2)c(OC2CCN(C(C)COc3ccccc3)CC2)c1 |
| InChI | InChI=1S/C26H34N2O4/c1-20(19-31-21-8-4-3-5-9-21)27-16-12-22(13-17-27)32-25-18-23(30-2)10-11-24(25)26(29)28-14-6-7-15-28/h3-5,8-11,18,20,22H,6-7,12-17,19H2,1-2H3 |
| InChIKey | KAZUPSLQVNOPLS-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |