C9H19N2O+ — CID 42148489
(2S)-N-tert-butylpyrrolidin-1-ium-2-carboxamide (PubChem CID 42148489) has the molecular formula C9H19N2O+ and a molecular weight of 171.26 g/mol. Its IUPAC name is (2S)-N-tert-butylpyrrolidin-1-ium-2-carboxamide.
| Compound Name | (2S)-N-tert-butylpyrrolidin-1-ium-2-carboxamide |
|---|---|
| PubChem CID | 42148489 |
| Molecular Formula | C9H19N2O+ |
| Molecular Weight | 171.26 g/mol |
| Exact Mass | 171.15 |
| IUPAC Name | (2S)-N-tert-butylpyrrolidin-1-ium-2-carboxamide |
| SMILES | CC(C)(C)NC(=O)[C@@H]1CCC[NH2+]1 |
| InChI | InChI=1S/C9H18N2O/c1-9(2,3)11-8(12)7-5-4-6-10-7/h7,10H,4-6H2,1-3H3,(H,11,12)/p+1/t7-/m0/s1 |
| InChIKey | BNUUSRSYNZFTBX-ZETCQYMHSA-O |
| XLogP | -0.37 |
| TPSA | 45.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.26 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |