C29H25N3O6 — CID 42155498
methyl 2-[(10S,15R)-10-(2,5-dimethoxyphenyl)-12,14-dioxo-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl]benzoate (PubChem CID 42155498) has the molecular formula C29H25N3O6 and a molecular weight of 511.53 g/mol. Its IUPAC name is methyl 2-[(10S,15R)-10-(2,5-dimethoxyphenyl)-12,14-dioxo-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl]benzoate.
| Compound Name | methyl 2-[(10S,15R)-10-(2,5-dimethoxyphenyl)-12,14-dioxo-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl]benzoate |
|---|---|
| PubChem CID | 42155498 |
| Molecular Formula | C29H25N3O6 |
| Molecular Weight | 511.53 g/mol |
| Exact Mass | 511.17 |
| IUPAC Name | methyl 2-[(10S,15R)-10-(2,5-dimethoxyphenyl)-12,14-dioxo-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraen-13-yl]benzoate |
| SMILES | COC(=O)c1ccccc1N1C(=O)[C@H]2Cc3c([nH]c4ccccc34)[C@H](c3cc(OC)ccc3OC)N2C1=O |
| InChI | InChI=1S/C29H25N3O6/c1-36-16-12-13-24(37-2)20(14-16)26-25-19(17-8-4-6-10-21(17)30-25)15-23-27(33)32(29(35)31(23)26)22-11-7-5-9-18(22)28(34)38-3/h4-14,23,26,30H,15H2,1-3H3/t23-,26+/m1/s1 |
| InChIKey | QANIKQTVJIEGMP-BVAGGSTKSA-N |
| XLogP | 4.45 |
| TPSA | 101.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.53 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|