C24H25F3N4O — CID 42155853
3-phenyl-N-[2-[1-[(2,3,6-trifluorophenyl)methyl]piperidin-4-yl]pyrazol-3-yl]propanamide (PubChem CID 42155853) has the molecular formula C24H25F3N4O and a molecular weight of 442.49 g/mol. Its IUPAC name is 3-phenyl-N-[2-[1-[(2,3,6-trifluorophenyl)methyl]piperidin-4-yl]pyrazol-3-yl]propanamide.
| Compound Name | 3-phenyl-N-[2-[1-[(2,3,6-trifluorophenyl)methyl]piperidin-4-yl]pyrazol-3-yl]propanamide |
|---|---|
| PubChem CID | 42155853 |
| Molecular Formula | C24H25F3N4O |
| Molecular Weight | 442.49 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | 3-phenyl-N-[2-[1-[(2,3,6-trifluorophenyl)methyl]piperidin-4-yl]pyrazol-3-yl]propanamide |
| SMILES | O=C(CCc1ccccc1)Nc1ccnn1C1CCN(Cc2c(F)ccc(F)c2F)CC1 |
| InChI | InChI=1S/C24H25F3N4O/c25-20-7-8-21(26)24(27)19(20)16-30-14-11-18(12-15-30)31-22(10-13-28-31)29-23(32)9-6-17-4-2-1-3-5-17/h1-5,7-8,10,13,18H,6,9,11-12,14-16H2,(H,29,32) |
| InChIKey | HBGGRVVOLYSKJX-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.49 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|