C21H27N5OS — CID 42160894
2-[(4-cyclopropyl-5-piperidin-1-yl-1,2,4-triazol-3-yl)sulfanyl]-N-phenyl-N-prop-2-enylacetamide (PubChem CID 42160894) has the molecular formula C21H27N5OS and a molecular weight of 397.55 g/mol. Its IUPAC name is 2-[(4-cyclopropyl-5-piperidin-1-yl-1,2,4-triazol-3-yl)sulfanyl]-N-phenyl-N-prop-2-enylacetamide.
| Compound Name | 2-[(4-cyclopropyl-5-piperidin-1-yl-1,2,4-triazol-3-yl)sulfanyl]-N-phenyl-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 42160894 |
| Molecular Formula | C21H27N5OS |
| Molecular Weight | 397.55 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | 2-[(4-cyclopropyl-5-piperidin-1-yl-1,2,4-triazol-3-yl)sulfanyl]-N-phenyl-N-prop-2-enylacetamide |
| SMILES | C=CCN(C(=O)CSc1nnc(N2CCCCC2)n1C1CC1)c1ccccc1 |
| InChI | InChI=1S/C21H27N5OS/c1-2-13-25(17-9-5-3-6-10-17)19(27)16-28-21-23-22-20(26(21)18-11-12-18)24-14-7-4-8-15-24/h2-3,5-6,9-10,18H,1,4,7-8,11-16H2 |
| InChIKey | UNFXTOZAKPBVCD-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.55 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|