C22H27N5OS — CID 42162525
2-[(4S,6R)-6-methyl-2-sulfanylidene-1,3-diazinan-4-yl]-1-[4-(2-phenylpyrimidin-4-yl)piperidin-1-yl]ethanone (PubChem CID 42162525) has the molecular formula C22H27N5OS and a molecular weight of 409.56 g/mol. Its IUPAC name is 2-[(4S,6R)-6-methyl-2-sulfanylidene-1,3-diazinan-4-yl]-1-[4-(2-phenylpyrimidin-4-yl)piperidin-1-yl]ethanone.
| Compound Name | 2-[(4S,6R)-6-methyl-2-sulfanylidene-1,3-diazinan-4-yl]-1-[4-(2-phenylpyrimidin-4-yl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 42162525 |
| Molecular Formula | C22H27N5OS |
| Molecular Weight | 409.56 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | 2-[(4S,6R)-6-methyl-2-sulfanylidene-1,3-diazinan-4-yl]-1-[4-(2-phenylpyrimidin-4-yl)piperidin-1-yl]ethanone |
| SMILES | C[C@@H]1C[C@@H](CC(=O)N2CCC(c3ccnc(-c4ccccc4)n3)CC2)NC(=S)N1 |
| InChI | InChI=1S/C22H27N5OS/c1-15-13-18(25-22(29)24-15)14-20(28)27-11-8-16(9-12-27)19-7-10-23-21(26-19)17-5-3-2-4-6-17/h2-7,10,15-16,18H,8-9,11-14H2,1H3,(H2,24,25,29)/t15-,18+/m1/s1 |
| InChIKey | XCGHNPPPWWZZOK-QAPCUYQASA-N |
| XLogP | 2.86 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.56 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|