C20H20N6O — CID 70877831
4-(2-phenylpyrimidin-4-yl)-N-pyridazin-3-ylpiperidine-1-carboxamide (PubChem CID 70877831) has the molecular formula C20H20N6O and a molecular weight of 360.42 g/mol. Its IUPAC name is 4-(2-phenylpyrimidin-4-yl)-N-pyridazin-3-ylpiperidine-1-carboxamide.
| Compound Name | 4-(2-phenylpyrimidin-4-yl)-N-pyridazin-3-ylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 70877831 |
| Molecular Formula | C20H20N6O |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | 4-(2-phenylpyrimidin-4-yl)-N-pyridazin-3-ylpiperidine-1-carboxamide |
| SMILES | O=C(Nc1cccnn1)N1CCC(c2ccnc(-c3ccccc3)n2)CC1 |
| InChI | InChI=1S/C20H20N6O/c27-20(24-18-7-4-11-22-25-18)26-13-9-15(10-14-26)17-8-12-21-19(23-17)16-5-2-1-3-6-16/h1-8,11-12,15H,9-10,13-14H2,(H,24,25,27) |
| InChIKey | ZBOONFXKCLCSOY-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 83.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |