C17H20ClN5O3S — CID 42164515
2-(2-chlorophenoxy)-N-[2-[4-(thiomorpholine-4-carbonyl)triazol-1-yl]ethyl]acetamide (PubChem CID 42164515) has the molecular formula C17H20ClN5O3S and a molecular weight of 409.90 g/mol. Its IUPAC name is 2-(2-chlorophenoxy)-N-[2-[4-(thiomorpholine-4-carbonyl)triazol-1-yl]ethyl]acetamide.
| Compound Name | 2-(2-chlorophenoxy)-N-[2-[4-(thiomorpholine-4-carbonyl)triazol-1-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 42164515 |
| Molecular Formula | C17H20ClN5O3S |
| Molecular Weight | 409.90 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | 2-(2-chlorophenoxy)-N-[2-[4-(thiomorpholine-4-carbonyl)triazol-1-yl]ethyl]acetamide |
| SMILES | O=C(COc1ccccc1Cl)NCCn1cc(C(=O)N2CCSCC2)nn1 |
| InChI | InChI=1S/C17H20ClN5O3S/c18-13-3-1-2-4-15(13)26-12-16(24)19-5-6-23-11-14(20-21-23)17(25)22-7-9-27-10-8-22/h1-4,11H,5-10,12H2,(H,19,24) |
| InChIKey | RZLZAPWPQUUKRZ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.90 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |