C20H20F2N4O2 — CID 4216465
N-[1-[4-(difluoromethoxy)phenyl]ethylideneamino]-1-ethyl-2-methylbenzimidazole-5-carboxamide (PubChem CID 4216465) has the molecular formula C20H20F2N4O2 and a molecular weight of 386.40 g/mol. Its IUPAC name is N-[1-[4-(difluoromethoxy)phenyl]ethylideneamino]-1-ethyl-2-methylbenzimidazole-5-carboxamide.
| Compound Name | N-[1-[4-(difluoromethoxy)phenyl]ethylideneamino]-1-ethyl-2-methylbenzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 4216465 |
| Molecular Formula | C20H20F2N4O2 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | N-[1-[4-(difluoromethoxy)phenyl]ethylideneamino]-1-ethyl-2-methylbenzimidazole-5-carboxamide |
| SMILES | CCn1c(C)nc2cc(C(=O)NN=C(C)c3ccc(OC(F)F)cc3)ccc21 |
| InChI | InChI=1S/C20H20F2N4O2/c1-4-26-13(3)23-17-11-15(7-10-18(17)26)19(27)25-24-12(2)14-5-8-16(9-6-14)28-20(21)22/h5-11,20H,4H2,1-3H3,(H,25,27) |
| InChIKey | ZVCJAPKXXMQKID-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 68.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|