C25H26N6O2S — CID 3933047
1-ethyl-N-[1-[4-methoxy-3-(pyrimidin-2-ylsulfanylmethyl)phenyl]ethylideneamino]-2-methylbenzimidazole-5-carboxamide (PubChem CID 3933047) has the molecular formula C25H26N6O2S and a molecular weight of 474.59 g/mol. Its IUPAC name is 1-ethyl-N-[1-[4-methoxy-3-(pyrimidin-2-ylsulfanylmethyl)phenyl]ethylideneamino]-2-methylbenzimidazole-5-carboxamide.
| Compound Name | 1-ethyl-N-[1-[4-methoxy-3-(pyrimidin-2-ylsulfanylmethyl)phenyl]ethylideneamino]-2-methylbenzimidazole-5-carboxamide |
|---|---|
| PubChem CID | 3933047 |
| Molecular Formula | C25H26N6O2S |
| Molecular Weight | 474.59 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | 1-ethyl-N-[1-[4-methoxy-3-(pyrimidin-2-ylsulfanylmethyl)phenyl]ethylideneamino]-2-methylbenzimidazole-5-carboxamide |
| SMILES | CCn1c(C)nc2cc(C(=O)NN=C(C)c3ccc(OC)c(CSc4ncccn4)c3)ccc21 |
| InChI | InChI=1S/C25H26N6O2S/c1-5-31-17(3)28-21-14-19(7-9-22(21)31)24(32)30-29-16(2)18-8-10-23(33-4)20(13-18)15-34-25-26-11-6-12-27-25/h6-14H,5,15H2,1-4H3,(H,30,32) |
| InChIKey | BTINVDVCAMHWIF-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 94.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.59 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|